C29H30FN5O3 — CID 175829426
tert-butyl 2-[8-[2-fluoro-4-(1-phenylethoxy)phenyl]-7H-purin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 175829426) has the molecular formula C29H30FN5O3 and a molecular weight of 515.59 g/mol. Its IUPAC name is tert-butyl 2-[8-[2-fluoro-4-(1-phenylethoxy)phenyl]-7H-purin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 2-[8-[2-fluoro-4-(1-phenylethoxy)phenyl]-7H-purin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 175829426 |
| Molecular Formula | C29H30FN5O3 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | tert-butyl 2-[8-[2-fluoro-4-(1-phenylethoxy)phenyl]-7H-purin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(Oc1ccc(-c2nc3ncnc(C4CC=CCN4C(=O)OC(C)(C)C)c3[nH]2)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C29H30FN5O3/c1-18(19-10-6-5-7-11-19)37-20-13-14-21(22(30)16-20)26-33-25-24(31-17-32-27(25)34-26)23-12-8-9-15-35(23)28(36)38-29(2,3)4/h5-11,13-14,16-18,23H,12,15H2,1-4H3,(H,31,32,33,34) |
| InChIKey | SDRRDSYNFJBJBG-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|