C16H19BrN4O2 — CID 175829353
tert-butyl 2-(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 175829353) has the molecular formula C16H19BrN4O2 and a molecular weight of 379.26 g/mol. Its IUPAC name is tert-butyl 2-(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 2-(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 175829353 |
| Molecular Formula | C16H19BrN4O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | tert-butyl 2-(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CCC1c1ncnc2[nH]c(Br)cc12 |
| InChI | InChI=1S/C16H19BrN4O2/c1-16(2,3)23-15(22)21-7-5-4-6-11(21)13-10-8-12(17)20-14(10)19-9-18-13/h4-5,8-9,11H,6-7H2,1-3H3,(H,18,19,20) |
| InChIKey | QCJXQCRLWVCKTM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|