C14H16O4S — CID 175832316
6-(4-methoxyphenyl)-6-methylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 175832316) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-6-methylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 6-(4-methoxyphenyl)-6-methylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 175832316 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-(4-methoxyphenyl)-6-methylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | COc1ccc(C2(C)C=CC=CC2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H16O4S/c1-14(11-6-8-12(18-2)9-7-11)10-4-3-5-13(14)19(15,16)17/h3-10,13H,1-2H3,(H,15,16,17) |
| InChIKey | FMMRQEBAHQPIRB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|