C18H17NO3 — CID 67226377
3-[6-cyano-5-(4-methoxyphenyl)-5-methylcyclohexa-1,3-dien-1-yl]prop-2-enoic acid (PubChem CID 67226377) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[6-cyano-5-(4-methoxyphenyl)-5-methylcyclohexa-1,3-dien-1-yl]prop-2-enoic acid.
| Compound Name | 3-[6-cyano-5-(4-methoxyphenyl)-5-methylcyclohexa-1,3-dien-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67226377 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-[6-cyano-5-(4-methoxyphenyl)-5-methylcyclohexa-1,3-dien-1-yl]prop-2-enoic acid |
| SMILES | COc1ccc(C2(C)C=CC=C(C=CC(=O)O)C2C#N)cc1 |
| InChI | InChI=1S/C18H17NO3/c1-18(14-6-8-15(22-2)9-7-14)11-3-4-13(16(18)12-19)5-10-17(20)21/h3-11,16H,1-2H3,(H,20,21) |
| InChIKey | MGNKFOTYBVMFPA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|