C39H72N8O7 — CID 175833815
6-[[1-(2-aminoethyl)azetidin-3-yl]oxymethyl]-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone (PubChem CID 175833815) has the molecular formula C39H72N8O7 and a molecular weight of 765.05 g/mol. Its IUPAC name is 6-[[1-(2-aminoethyl)azetidin-3-yl]oxymethyl]-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone.
| Compound Name | 6-[[1-(2-aminoethyl)azetidin-3-yl]oxymethyl]-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone |
|---|---|
| PubChem CID | 175833815 |
| Molecular Formula | C39H72N8O7 |
| Molecular Weight | 765.05 g/mol |
| Exact Mass | 764.55 |
| IUPAC Name | 6-[[1-(2-aminoethyl)azetidin-3-yl]oxymethyl]-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone |
| SMILES | CCCCCCC1OCC(C)NC(=O)C(COC2CN(CCN)C2)NC(=O)C(CN)NC(=O)C(C2CCCCCC2)NC(=O)C(CCC)N(C)C(=O)C1C |
| InChI | InChI=1S/C39H72N8O7/c1-6-8-9-14-18-33-27(4)39(52)46(5)32(15-7-2)37(50)45-34(28-16-12-10-11-13-17-28)38(51)43-30(21-41)35(48)44-31(36(49)42-26(3)24-54-33)25-53-29-22-47(23-29)20-19-40/h26-34H,6-25,40-41H2,1-5H3,(H,42,49)(H,43,51)(H,44,48)(H,45,50) |
| InChIKey | WSWJZGOEIZEACE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 210.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.05 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|