C16H21NO3 — CID 175835175
4-(2-oxopyrrolidin-3-yl)butyl 2-phenylacetate (PubChem CID 175835175) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-3-yl)butyl 2-phenylacetate.
| Compound Name | 4-(2-oxopyrrolidin-3-yl)butyl 2-phenylacetate |
|---|---|
| PubChem CID | 175835175 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-(2-oxopyrrolidin-3-yl)butyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OCCCCC1CCNC1=O |
| InChI | InChI=1S/C16H21NO3/c18-15(12-13-6-2-1-3-7-13)20-11-5-4-8-14-9-10-17-16(14)19/h1-3,6-7,14H,4-5,8-12H2,(H,17,19) |
| InChIKey | UUCMWKRMKSHKJR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|