C13H13ClN2O3 — CID 175836767
chloromethyl 3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate (PubChem CID 175836767) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is chloromethyl 3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate.
| Compound Name | chloromethyl 3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 175836767 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | chloromethyl 3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate |
| SMILES | O=C(OCCl)c1ccc2ncn(C[C@@H]3CCO3)c2c1 |
| InChI | InChI=1S/C13H13ClN2O3/c14-7-19-13(17)9-1-2-11-12(5-9)16(8-15-11)6-10-3-4-18-10/h1-2,5,8,10H,3-4,6-7H2/t10-/m0/s1 |
| InChIKey | GGBQSMCTFVXHFK-JTQLQIEISA-N |
| XLogP | 2.18 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|