C16H14ClNO6 — CID 175839790
2-O-ethyl 3-O,4-O-dimethyl 6-chloroquinoline-2,3,4-tricarboxylate (PubChem CID 175839790) has the molecular formula C16H14ClNO6 and a molecular weight of 351.74 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl 6-chloroquinoline-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl 6-chloroquinoline-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 175839790 |
| Molecular Formula | C16H14ClNO6 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl 6-chloroquinoline-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)c1nc2ccc(Cl)cc2c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C16H14ClNO6/c1-4-24-16(21)13-12(15(20)23-3)11(14(19)22-2)9-7-8(17)5-6-10(9)18-13/h5-7H,4H2,1-3H3 |
| InChIKey | QVQCHSRIPPTQEL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|