C19H20N4O — CID 175840653
3-[(2R,4S)-2-methylpiperidin-4-yl]-2-pyridin-2-ylquinazolin-4-one (PubChem CID 175840653) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-[(2R,4S)-2-methylpiperidin-4-yl]-2-pyridin-2-ylquinazolin-4-one.
| Compound Name | 3-[(2R,4S)-2-methylpiperidin-4-yl]-2-pyridin-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 175840653 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-[(2R,4S)-2-methylpiperidin-4-yl]-2-pyridin-2-ylquinazolin-4-one |
| SMILES | C[C@@H]1C[C@@H](n2c(-c3ccccn3)nc3ccccc3c2=O)CCN1 |
| InChI | InChI=1S/C19H20N4O/c1-13-12-14(9-11-20-13)23-18(17-8-4-5-10-21-17)22-16-7-3-2-6-15(16)19(23)24/h2-8,10,13-14,20H,9,11-12H2,1H3/t13-,14+/m1/s1 |
| InChIKey | IXERPLAHJUXUJC-KGLIPLIRSA-N |
| XLogP | 2.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |