C13H12N2O3 — CID 175841757
5-(5-ethenylfuran-2-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 175841757) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-(5-ethenylfuran-2-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-(5-ethenylfuran-2-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175841757 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-(5-ethenylfuran-2-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | C=Cc1ccc(-c2c(C)[nH]cc(C(N)=O)c2=O)o1 |
| InChI | InChI=1S/C13H12N2O3/c1-3-8-4-5-10(18-8)11-7(2)15-6-9(12(11)16)13(14)17/h3-6H,1H2,2H3,(H2,14,17)(H,15,16) |
| InChIKey | FJQBHXFJEKQPHX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |