C10H9N3O2S — CID 175841842
6-methyl-4-oxo-5-(1,3-thiazol-2-yl)-1H-pyridine-3-carboxamide (PubChem CID 175841842) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 6-methyl-4-oxo-5-(1,3-thiazol-2-yl)-1H-pyridine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-5-(1,3-thiazol-2-yl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175841842 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 6-methyl-4-oxo-5-(1,3-thiazol-2-yl)-1H-pyridine-3-carboxamide |
| SMILES | Cc1[nH]cc(C(N)=O)c(=O)c1-c1nccs1 |
| InChI | InChI=1S/C10H9N3O2S/c1-5-7(10-12-2-3-16-10)8(14)6(4-13-5)9(11)15/h2-4H,1H3,(H2,11,15)(H,13,14) |
| InChIKey | MCBXSTACXYBFQF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |