C11H9N5 — CID 175842328
1-(pyridazin-3-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 175842328) has the molecular formula C11H9N5 and a molecular weight of 211.23 g/mol. Its IUPAC name is 1-(pyridazin-3-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 1-(pyridazin-3-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 175842328 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1-(pyridazin-3-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1cnnc(Cn2cnc3ncccc32)c1 |
| InChI | InChI=1S/C11H9N5/c1-3-9(15-14-6-1)7-16-8-13-11-10(16)4-2-5-12-11/h1-6,8H,7H2 |
| InChIKey | LGLFATLIEOAJSX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |