C18H17NO2 — CID 175844218
[(2S)-pyrrolidin-2-yl]-(9H-xanthen-9-yl)methanone (PubChem CID 175844218) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(2S)-pyrrolidin-2-yl]-(9H-xanthen-9-yl)methanone.
| Compound Name | [(2S)-pyrrolidin-2-yl]-(9H-xanthen-9-yl)methanone |
|---|---|
| PubChem CID | 175844218 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [(2S)-pyrrolidin-2-yl]-(9H-xanthen-9-yl)methanone |
| SMILES | O=C(C1c2ccccc2Oc2ccccc21)[C@@H]1CCCN1 |
| InChI | InChI=1S/C18H17NO2/c20-18(14-8-5-11-19-14)17-12-6-1-3-9-15(12)21-16-10-4-2-7-13(16)17/h1-4,6-7,9-10,14,17,19H,5,8,11H2/t14-/m0/s1 |
| InChIKey | ZNEUKHNWACDVMM-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |