C9H12F3N3O4S — CID 175844332
N-[(2S,5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide (PubChem CID 175844332) has the molecular formula C9H12F3N3O4S and a molecular weight of 315.27 g/mol. Its IUPAC name is N-[(2S,5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide.
| Compound Name | N-[(2S,5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide |
|---|---|
| PubChem CID | 175844332 |
| Molecular Formula | C9H12F3N3O4S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[(2S,5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide |
| SMILES | O=CN([C@H]1CC[C@@H]2CN1C(=O)N2)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O4S/c10-9(11,12)4-20(18,19)15(5-16)7-2-1-6-3-14(7)8(17)13-6/h5-7H,1-4H2,(H,13,17)/t6-,7+/m1/s1 |
| InChIKey | VJBVBNTXHFATPW-RQJHMYQMSA-N |
| XLogP | -0.15 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|