C9H13F3N3NaO8S2 — CID 175844331
sodium;N-[(2S,5R)-7-oxo-1-aza-6-azanidabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide;sulfuric acid (PubChem CID 175844331) has the molecular formula C9H13F3N3NaO8S2 and a molecular weight of 435.33 g/mol. Its IUPAC name is sodium;N-[(2S,5R)-7-oxo-1-aza-6-azanidabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide;sulfuric acid.
| Compound Name | sodium;N-[(2S,5R)-7-oxo-1-aza-6-azanidabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide;sulfuric acid |
|---|---|
| PubChem CID | 175844331 |
| Molecular Formula | C9H13F3N3NaO8S2 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | sodium;N-[(2S,5R)-7-oxo-1-aza-6-azanidabicyclo[3.2.1]octan-2-yl]-N-(2,2,2-trifluoroethylsulfonyl)formamide;sulfuric acid |
| SMILES | O=CN([C@H]1CC[C@@H]2CN1C(=O)[N-]2)S(=O)(=O)CC(F)(F)F.O=S(=O)(O)O.[Na+] |
| InChI | InChI=1S/C9H12F3N3O4S.Na.H2O4S/c10-9(11,12)4-20(18,19)15(5-16)7-2-1-6-3-14(7)8(17)13-6;;1-5(2,3)4/h5-7H,1-4H2,(H,13,17);;(H2,1,2,3,4)/q;+1;/p-1/t6-,7+;;/m1../s1 |
| InChIKey | VZRFVZPPYAPXOL-VJBFUYBPSA-M |
| XLogP | -3.01 |
| TPSA | 163.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|