C8H10F3N3O7S2 — CID 175844326
(2S,5R)-2-[formyl(trifluoromethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octane-6-sulfonic acid (PubChem CID 175844326) has the molecular formula C8H10F3N3O7S2 and a molecular weight of 381.31 g/mol. Its IUPAC name is (2S,5R)-2-[formyl(trifluoromethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octane-6-sulfonic acid.
| Compound Name | (2S,5R)-2-[formyl(trifluoromethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octane-6-sulfonic acid |
|---|---|
| PubChem CID | 175844326 |
| Molecular Formula | C8H10F3N3O7S2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | (2S,5R)-2-[formyl(trifluoromethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octane-6-sulfonic acid |
| SMILES | O=CN([C@H]1CC[C@@H]2CN1C(=O)N2S(=O)(=O)O)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O7S2/c9-8(10,11)22(17,18)13(4-15)6-2-1-5-3-12(6)7(16)14(5)23(19,20)21/h4-6H,1-3H2,(H,19,20,21)/t5-,6+/m1/s1 |
| InChIKey | IJVNTOWTSLARAB-RITPCOANSA-N |
| XLogP | -0.68 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|