C9H12F3N3O8S2 — CID 175844311
[(2S,5R)-2-[formyl(2,2,2-trifluoroethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844311) has the molecular formula C9H12F3N3O8S2 and a molecular weight of 411.34 g/mol. Its IUPAC name is [(2S,5R)-2-[formyl(2,2,2-trifluoroethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[formyl(2,2,2-trifluoroethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844311 |
| Molecular Formula | C9H12F3N3O8S2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | [(2S,5R)-2-[formyl(2,2,2-trifluoroethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=CN([C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O8S2/c10-9(11,12)4-24(18,19)14(5-16)7-2-1-6-3-13(7)8(17)15(6)23-25(20,21)22/h5-7H,1-4H2,(H,20,21,22)/t6-,7+/m1/s1 |
| InChIKey | FZQBAFUZHIWMKD-RQJHMYQMSA-N |
| XLogP | -0.70 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|