C9H15N3O8S2 — CID 175844303
[(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844303) has the molecular formula C9H15N3O8S2 and a molecular weight of 357.37 g/mol. Its IUPAC name is [(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844303 |
| Molecular Formula | C9H15N3O8S2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | [(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CCS(=O)(=O)N(C=O)[C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C9H15N3O8S2/c1-2-21(15,16)11(6-13)8-4-3-7-5-10(8)9(14)12(7)20-22(17,18)19/h6-8H,2-5H2,1H3,(H,17,18,19)/t7-,8+/m1/s1 |
| InChIKey | TZIXHWWTUKSMCU-SFYZADRCSA-N |
| XLogP | -1.25 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|