C13H20N4O9S2 — CID 175844312
[(2S,5R)-2-[[(3R)-1-acetylpyrrolidin-3-yl]sulfonyl-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844312) has the molecular formula C13H20N4O9S2 and a molecular weight of 440.46 g/mol. Its IUPAC name is [(2S,5R)-2-[[(3R)-1-acetylpyrrolidin-3-yl]sulfonyl-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[[(3R)-1-acetylpyrrolidin-3-yl]sulfonyl-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844312 |
| Molecular Formula | C13H20N4O9S2 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [(2S,5R)-2-[[(3R)-1-acetylpyrrolidin-3-yl]sulfonyl-formylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(=O)N1CC[C@@H](S(=O)(=O)N(C=O)[C@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H20N4O9S2/c1-9(19)14-5-4-11(7-14)27(21,22)16(8-18)12-3-2-10-6-15(12)13(20)17(10)26-28(23,24)25/h8,10-12H,2-7H2,1H3,(H,23,24,25)/t10-,11-,12+/m1/s1 |
| InChIKey | GEUGVPUONVPXSH-UTUOFQBUSA-N |
| XLogP | -1.64 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|