C12H20N4O10S3 — CID 175844316
[(2S,5R)-2-[formyl-[(3S)-1-methylsulfonylpyrrolidin-3-yl]sulfonylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844316) has the molecular formula C12H20N4O10S3 and a molecular weight of 476.51 g/mol. Its IUPAC name is [(2S,5R)-2-[formyl-[(3S)-1-methylsulfonylpyrrolidin-3-yl]sulfonylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[formyl-[(3S)-1-methylsulfonylpyrrolidin-3-yl]sulfonylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844316 |
| Molecular Formula | C12H20N4O10S3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | [(2S,5R)-2-[formyl-[(3S)-1-methylsulfonylpyrrolidin-3-yl]sulfonylamino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CS(=O)(=O)N1CC[C@H](S(=O)(=O)N(C=O)[C@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C12H20N4O10S3/c1-27(19,20)13-5-4-10(7-13)28(21,22)15(8-17)11-3-2-9-6-14(11)12(18)16(9)26-29(23,24)25/h8-11H,2-7H2,1H3,(H,23,24,25)/t9-,10+,11+/m1/s1 |
| InChIKey | NYYYDDHRCARSDA-VWYCJHECSA-N |
| XLogP | -2.23 |
| TPSA | 178.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|