C9H14N3NaO8S2 — CID 175844342
sodium [(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 175844342) has the molecular formula C9H14N3NaO8S2 and a molecular weight of 379.35 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 175844342 |
| Molecular Formula | C9H14N3NaO8S2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | sodium [(2S,5R)-2-[ethylsulfonyl(formyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | CCS(=O)(=O)N(C=O)[C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H15N3O8S2.Na/c1-2-21(15,16)11(6-13)8-4-3-7-5-10(8)9(14)12(7)20-22(17,18)19;/h6-8H,2-5H2,1H3,(H,17,18,19);/q;+1/p-1/t7-,8+;/m1./s1 |
| InChIKey | HJDCHZWRDYOIDQ-WLYNEOFISA-M |
| XLogP | -4.58 |
| TPSA | 144.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|