C13H23N5O8S2 — CID 175844306
[(2S,5R)-2-[formyl(2-piperazin-1-ylethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175844306) has the molecular formula C13H23N5O8S2 and a molecular weight of 441.49 g/mol. Its IUPAC name is [(2S,5R)-2-[formyl(2-piperazin-1-ylethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[formyl(2-piperazin-1-ylethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175844306 |
| Molecular Formula | C13H23N5O8S2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [(2S,5R)-2-[formyl(2-piperazin-1-ylethylsulfonyl)amino]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=CN([C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)S(=O)(=O)CCN1CCNCC1 |
| InChI | InChI=1S/C13H23N5O8S2/c19-10-17(27(21,22)8-7-15-5-3-14-4-6-15)12-2-1-11-9-16(12)13(20)18(11)26-28(23,24)25/h10-12,14H,1-9H2,(H,23,24,25)/t11-,12+/m1/s1 |
| InChIKey | NRHPJLIZHGJUOJ-NEPJUHHUSA-N |
| XLogP | -2.36 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|