C13H24N6O7S2 — CID 174229668
[7-oxo-2-[N'-(2-piperazin-1-ylethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174229668) has the molecular formula C13H24N6O7S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is [7-oxo-2-[N'-(2-piperazin-1-ylethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-[N'-(2-piperazin-1-ylethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174229668 |
| Molecular Formula | C13H24N6O7S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [7-oxo-2-[N'-(2-piperazin-1-ylethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=NS(=O)(=O)CCN1CCNCC1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H24N6O7S2/c14-12(16-27(21,22)8-7-17-5-3-15-4-6-17)11-2-1-10-9-18(11)13(20)19(10)26-28(23,24)25/h10-11,15H,1-9H2,(H2,14,16)(H,23,24,25) |
| InChIKey | WBAPIYZAORYZJZ-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 174.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|