C9H13F3N4O7S2 — CID 174229735
[7-oxo-2-[N'-(2,2,2-trifluoroethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174229735) has the molecular formula C9H13F3N4O7S2 and a molecular weight of 410.35 g/mol. Its IUPAC name is [7-oxo-2-[N'-(2,2,2-trifluoroethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-[N'-(2,2,2-trifluoroethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174229735 |
| Molecular Formula | C9H13F3N4O7S2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | [7-oxo-2-[N'-(2,2,2-trifluoroethylsulfonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=NS(=O)(=O)CC(F)(F)F)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C9H13F3N4O7S2/c10-9(11,12)4-24(18,19)14-7(13)6-2-1-5-3-15(6)8(17)16(5)23-25(20,21)22/h5-6H,1-4H2,(H2,13,14)(H,20,21,22) |
| InChIKey | RPRJWMVHKRAXJL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|