C9H13F3N4O4S — CID 174226971
(2S,5R)-6-hydroxy-7-oxo-N'-(2,2,2-trifluoroethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 174226971) has the molecular formula C9H13F3N4O4S and a molecular weight of 330.29 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-N'-(2,2,2-trifluoroethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-N'-(2,2,2-trifluoroethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 174226971 |
| Molecular Formula | C9H13F3N4O4S |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-N'-(2,2,2-trifluoroethylsulfonyl)-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | NC(=NS(=O)(=O)CC(F)(F)F)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C9H13F3N4O4S/c10-9(11,12)4-21(19,20)14-7(13)6-2-1-5-3-15(6)8(17)16(5)18/h5-6,18H,1-4H2,(H2,13,14)/t5-,6+/m1/s1 |
| InChIKey | KRWYTWHGHKRCQC-RITPCOANSA-N |
| XLogP | -0.11 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|