C7H9F3N2O7S2 — CID 162649357
[(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 162649357) has the molecular formula C7H9F3N2O7S2 and a molecular weight of 354.28 g/mol. Its IUPAC name is [(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162649357 |
| Molecular Formula | C7H9F3N2O7S2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | [(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C1N2C[C@@H](CC[C@H]2S(=O)(=O)C(F)(F)F)N1OS(=O)(=O)O |
| InChI | InChI=1S/C7H9F3N2O7S2/c8-7(9,10)20(14,15)5-2-1-4-3-11(5)6(13)12(4)19-21(16,17)18/h4-5H,1-3H2,(H,16,17,18)/t4-,5-/m1/s1 |
| InChIKey | RWCNRBUSGCOQJD-RFZPGFLSSA-N |
| XLogP | -0.12 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|