C7H8F3N2NaO7S2 — CID 162649356
sodium [(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 162649356) has the molecular formula C7H8F3N2NaO7S2 and a molecular weight of 376.27 g/mol. Its IUPAC name is sodium [(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 162649356 |
| Molecular Formula | C7H8F3N2NaO7S2 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | sodium [(2R,5R)-7-oxo-2-(trifluoromethylsulfonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C1N2C[C@@H](CC[C@H]2S(=O)(=O)C(F)(F)F)N1OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H9F3N2O7S2.Na/c8-7(9,10)20(14,15)5-2-1-4-3-11(5)6(13)12(4)19-21(16,17)18;/h4-5H,1-3H2,(H,16,17,18);/q;+1/p-1/t4-,5-;/m1./s1 |
| InChIKey | HENNWPZFRGGNRR-TYSVMGFPSA-M |
| XLogP | -3.46 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|