C7H9F3N2O5S2 — CID 175964827
[(2R,5S)-7-oxo-2-(trifluoromethylsulfanyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175964827) has the molecular formula C7H9F3N2O5S2 and a molecular weight of 322.29 g/mol. Its IUPAC name is [(2R,5S)-7-oxo-2-(trifluoromethylsulfanyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-7-oxo-2-(trifluoromethylsulfanyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175964827 |
| Molecular Formula | C7H9F3N2O5S2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | [(2R,5S)-7-oxo-2-(trifluoromethylsulfanyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C1N2C[C@H](CC[C@H]2SC(F)(F)F)N1OS(=O)(=O)O |
| InChI | InChI=1S/C7H9F3N2O5S2/c8-7(9,10)18-5-2-1-4-3-11(5)6(13)12(4)17-19(14,15)16/h4-5H,1-3H2,(H,14,15,16)/t4-,5+/m0/s1 |
| InChIKey | NJWAICWKJGYKIZ-CRCLSJGQSA-N |
| XLogP | 1.20 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|