C7H9F3N2O5S — CID 165149744
[7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 165149744) has the molecular formula C7H9F3N2O5S and a molecular weight of 290.22 g/mol. Its IUPAC name is [7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 165149744 |
| Molecular Formula | C7H9F3N2O5S |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | [7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C1N2CC(CCC2C(F)(F)F)N1OS(=O)(=O)O |
| InChI | InChI=1S/C7H9F3N2O5S/c8-7(9,10)5-2-1-4-3-11(5)6(13)12(4)17-18(14,15)16/h4-5H,1-3H2,(H,14,15,16) |
| InChIKey | HBZZIEWMWUFHDH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|