C9H12F3N3O6S — CID 122525493
[(2S)-7-oxo-2-[[(2,2,2-trifluoroacetyl)amino]methyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 122525493) has the molecular formula C9H12F3N3O6S and a molecular weight of 347.27 g/mol. Its IUPAC name is [(2S)-7-oxo-2-[[(2,2,2-trifluoroacetyl)amino]methyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-7-oxo-2-[[(2,2,2-trifluoroacetyl)amino]methyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 122525493 |
| Molecular Formula | C9H12F3N3O6S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | [(2S)-7-oxo-2-[[(2,2,2-trifluoroacetyl)amino]methyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C1N(OS(=O)(=O)O)C2CC[C@@H](CNC(=O)C(F)(F)F)N1C2 |
| InChI | InChI=1S/C9H12F3N3O6S/c10-9(11,12)7(16)13-3-5-1-2-6-4-14(5)8(17)15(6)21-22(18,19)20/h5-6H,1-4H2,(H,13,16)(H,18,19,20)/t5-,6?/m0/s1 |
| InChIKey | VIXBZFPZDFAIIO-ZBHICJROSA-N |
| XLogP | -0.33 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|