C10H13F3N4O6S — CID 170519353
[(5R)-7-oxo-2-[N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 170519353) has the molecular formula C10H13F3N4O6S and a molecular weight of 374.30 g/mol. Its IUPAC name is [(5R)-7-oxo-2-[N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(5R)-7-oxo-2-[N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170519353 |
| Molecular Formula | C10H13F3N4O6S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | [(5R)-7-oxo-2-[N-(3,3,3-trifluoropropanoyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\NC(=O)CC(F)(F)F)C1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H13F3N4O6S/c11-10(12,13)3-7(18)15-8(14)6-2-1-5-4-16(6)9(19)17(5)23-24(20,21)22/h5-6H,1-4H2,(H2,14,15,18)(H,20,21,22)/t5-,6?/m1/s1 |
| InChIKey | QOJWTELMYKKROC-LWOQYNTDSA-N |
| XLogP | 0.04 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|