C8H12F2N2O5S — CID 175925389
[2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175925389) has the molecular formula C8H12F2N2O5S and a molecular weight of 286.26 g/mol. Its IUPAC name is [2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175925389 |
| Molecular Formula | C8H12F2N2O5S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [2-(1,1-difluoroethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(F)(F)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C8H12F2N2O5S/c1-8(9,10)6-3-2-5-4-11(6)7(13)12(5)17-18(14,15)16/h5-6H,2-4H2,1H3,(H,14,15,16) |
| InChIKey | ZBOMXZLEHOOFLX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|