C7H10F2N2O2 — CID 146337179
(2S,5R)-2-(difluoromethyl)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 146337179) has the molecular formula C7H10F2N2O2 and a molecular weight of 192.16 g/mol. Its IUPAC name is (2S,5R)-2-(difluoromethyl)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-2-(difluoromethyl)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 146337179 |
| Molecular Formula | C7H10F2N2O2 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | (2S,5R)-2-(difluoromethyl)-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(O)[C@@H]2CC[C@@H](C(F)F)N1C2 |
| InChI | InChI=1S/C7H10F2N2O2/c8-6(9)5-2-1-4-3-10(5)7(12)11(4)13/h4-6,13H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | DSSPMTVZIIJTKZ-UHNVWZDZSA-N |
| XLogP | 0.91 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|