C20H21ClN2O2 — CID 175846671
2-[(4-chloro-2-methyl-1-benzofuran-7-yl)methoxy]-6-(1-deuteriopiperidin-4-yl)pyridine (PubChem CID 175846671) has the molecular formula C20H21ClN2O2 and a molecular weight of 357.86 g/mol. Its IUPAC name is 2-[(4-chloro-2-methyl-1-benzofuran-7-yl)methoxy]-6-(1-deuteriopiperidin-4-yl)pyridine.
| Compound Name | 2-[(4-chloro-2-methyl-1-benzofuran-7-yl)methoxy]-6-(1-deuteriopiperidin-4-yl)pyridine |
|---|---|
| PubChem CID | 175846671 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[(4-chloro-2-methyl-1-benzofuran-7-yl)methoxy]-6-(1-deuteriopiperidin-4-yl)pyridine |
| SMILES | [2H]N1CCC(c2cccc(OCc3ccc(Cl)c4cc(C)oc34)n2)CC1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-13-11-16-17(21)6-5-15(20(16)25-13)12-24-19-4-2-3-18(23-19)14-7-9-22-10-8-14/h2-6,11,14,22H,7-10,12H2,1H3/i/hD |
| InChIKey | BUDXUGMHJBHQPZ-DYCDLGHISA-N |
| XLogP | 4.84 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |