C29H48O2 — CID 175847812
(5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione (PubChem CID 175847812) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione.
| Compound Name | (5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione |
|---|---|
| PubChem CID | 175847812 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-6,7-dione |
| SMILES | CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)C(=O)[C@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C29H48O2/c1-7-20(18(2)3)12-11-19(4)21-13-14-22-25-23(15-17-29(21,22)6)28(5)16-9-8-10-24(28)26(30)27(25)31/h18-25H,7-17H2,1-6H3/t19-,20-,21-,22+,23+,24-,25+,28-,29-/m1/s1 |
| InChIKey | RWJAOTZUEOMDGA-CWSYDSCGSA-N |
| XLogP | 7.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|