C25H29N9O — CID 175850730
2-azido-2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]nonan-4-one (PubChem CID 175850730) has the molecular formula C25H29N9O and a molecular weight of 471.57 g/mol. Its IUPAC name is 2-azido-2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]nonan-4-one.
| Compound Name | 2-azido-2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 175850730 |
| Molecular Formula | C25H29N9O |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 2-azido-2-butyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-diazaspiro[4.4]nonan-4-one |
| SMILES | CCCCC1(N=[N+]=[N-])NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H29N9O/c1-2-3-16-25(30-31-26)29-24(14-6-7-15-24)23(35)34(25)17-18-10-12-19(13-11-18)20-8-4-5-9-21(20)22-27-32-33-28-22/h4-5,8-13,29H,2-3,6-7,14-17H2,1H3,(H,27,28,32,33) |
| InChIKey | VXFRTPPWSNVUFA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|