C24H28N6O — CID 67903159
5,5-dimethyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one (PubChem CID 67903159) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 5,5-dimethyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one.
| Compound Name | 5,5-dimethyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one |
|---|---|
| PubChem CID | 67903159 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 5,5-dimethyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-one |
| SMILES | CCCCCC1=NC(C)(C)C(=O)N1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C24H28N6O/c1-4-5-6-11-21-25-24(2,3)23(31)30(21)16-17-12-14-18(15-13-17)19-9-7-8-10-20(19)22-26-28-29-27-22/h7-10,12-15H,4-6,11,16H2,1-3H3,(H,26,27,28,29) |
| InChIKey | NUWJQJOZIWOUBC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|