C10H15N2O15P3 — CID 175851858
[[(2R,3S,5S)-5-(2,4-dioxopyrimidin-1-yl)-5-formyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 175851858) has the molecular formula C10H15N2O15P3 and a molecular weight of 496.15 g/mol. Its IUPAC name is [[(2R,3S,5S)-5-(2,4-dioxopyrimidin-1-yl)-5-formyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5S)-5-(2,4-dioxopyrimidin-1-yl)-5-formyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 175851858 |
| Molecular Formula | C10H15N2O15P3 |
| Molecular Weight | 496.15 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | [[(2R,3S,5S)-5-(2,4-dioxopyrimidin-1-yl)-5-formyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C[C@]1(n2ccc(=O)[nH]c2=O)C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H15N2O15P3/c13-5-10(12-2-1-8(15)11-9(12)16)3-6(14)7(25-10)4-24-29(20,21)27-30(22,23)26-28(17,18)19/h1-2,5-7,14H,3-4H2,(H,20,21)(H,22,23)(H,11,15,16)(H2,17,18,19)/t6-,7+,10-/m0/s1 |
| InChIKey | QFWSWMATRSSRRQ-PJKMHFRUSA-N |
| XLogP | -2.12 |
| TPSA | 261.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.15 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|