C13H12NNaO6 — CID 175851971
sodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate;3-ethynylpyridine (PubChem CID 175851971) has the molecular formula C13H12NNaO6 and a molecular weight of 301.23 g/mol. Its IUPAC name is sodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate;3-ethynylpyridine.
| Compound Name | sodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate;3-ethynylpyridine |
|---|---|
| PubChem CID | 175851971 |
| Molecular Formula | C13H12NNaO6 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | sodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate;3-ethynylpyridine |
| SMILES | C#Cc1cccnc1.O=C1O[C@H]([C@@H](O)CO)C([O-])=C1O.[Na+] |
| InChI | InChI=1S/C7H5N.C6H8O6.Na/c1-2-7-4-3-5-8-6-7;7-1-2(8)5-3(9)4(10)6(11)12-5;/h1,3-6H;2,5,7-10H,1H2;/q;;+1/p-1/t;2-,5+;/m.0./s1 |
| InChIKey | LKTGGIZCLKBTBJ-OHNFFSBGSA-M |
| XLogP | -4.54 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|