C25H19F3N4O4 — CID 175853028
2-[2-[[(1R,11S)-4-oxo-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-6-yl]oxymethyl]phenoxy]-5-(trifluoromethyl)benzonitrile (PubChem CID 175853028) has the molecular formula C25H19F3N4O4 and a molecular weight of 496.45 g/mol. Its IUPAC name is 2-[2-[[(1R,11S)-4-oxo-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-6-yl]oxymethyl]phenoxy]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[2-[[(1R,11S)-4-oxo-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-6-yl]oxymethyl]phenoxy]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 175853028 |
| Molecular Formula | C25H19F3N4O4 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 2-[2-[[(1R,11S)-4-oxo-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-6-yl]oxymethyl]phenoxy]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1Oc1ccccc1COc1cc2n(c(=O)n1)C[C@]13CO[C@H](CN21)C3 |
| InChI | InChI=1S/C25H19F3N4O4/c26-25(27,28)17-5-6-20(16(7-17)10-29)36-19-4-2-1-3-15(19)12-34-21-8-22-31(23(33)30-21)13-24-9-18(35-14-24)11-32(22)24/h1-8,18H,9,11-14H2/t18-,24+/m0/s1 |
| InChIKey | HOFZLVHCIFPTJW-MHECFPHRSA-N |
| XLogP | 3.87 |
| TPSA | 89.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |