C30H41NOSi — CID 175854756
N-[phenyl-[2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxy]cyclohexanimine (PubChem CID 175854756) has the molecular formula C30H41NOSi and a molecular weight of 459.75 g/mol. Its IUPAC name is N-[phenyl-[2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxy]cyclohexanimine.
| Compound Name | N-[phenyl-[2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxy]cyclohexanimine |
|---|---|
| PubChem CID | 175854756 |
| Molecular Formula | C30H41NOSi |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | N-[phenyl-[2-[2-tri(propan-2-yl)silylethynyl]phenyl]methoxy]cyclohexanimine |
| SMILES | CC(C)[Si](C#Cc1ccccc1C(ON=C1CCCCC1)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H41NOSi/c1-23(2)33(24(3)4,25(5)6)22-21-26-15-13-14-20-29(26)30(27-16-9-7-10-17-27)32-31-28-18-11-8-12-19-28/h7,9-10,13-17,20,23-25,30H,8,11-12,18-19H2,1-6H3 |
| InChIKey | RJORFIJIXCOLQU-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|