About (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one
(3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 175857059) has the molecular formula C16H11BrClFN2O
and a molecular weight of 381.63 g/mol. Its IUPAC name is (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| PubChem CID | 175857059 |
| Molecular Formula | C16H11BrClFN2O |
| Molecular Weight | 381.63 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | C[C@H]1N=C(c2ccccc2F)c2c(ccc(Br)c2Cl)NC1=O |
| InChI | InChI=1S/C16H11BrClFN2O/c1-8-16(22)21-12-7-6-10(17)14(18)13(12)15(20-8)9-4-2-3-5-11(9)19/h2-8H,1H3,(H,21,22)/t8-/m1/s1 |
| InChIKey | LBJHBDUHMIGCFC-MRVPVSSYSA-N |
| XLogP | 4.42 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one?
The IUPAC name of (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one (CID 175857059) is (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one.
What is the SMILES notation for (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one?
The canonical SMILES for (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one is C[C@H]1N=C(c2ccccc2F)c2c(ccc(Br)c2Cl)NC1=O.
What is the InChIKey of (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one?
The InChIKey is LBJHBDUHMIGCFC-MRVPVSSYSA-N. The full InChI is InChI=1S/C16H11BrClFN2O/c1-8-16(22)21-12-7-6-10(17)14(18)13(12)15(20-8)9-4-2-3-5-11(9)19/h2-8H,1H3,(H,21,22)/t8-/m1/s1.
What are the key properties of (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one?
(3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one has a molecular weight of 381.63 g/mol, XLogP of 4.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-7-bromo-6-chloro-5-(2-fluorophenyl)-3-methyl-1,3-dihydro-1,4-benzodiazepin-2-one is sourced from PubChem (CID 175857059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).