C17H15ClFN3O — CID 54545945
(3S)-7-amino-6-chloro-5-(2-fluorophenyl)-1,3-dimethyl-3H-1,4-benzodiazepin-2-one (PubChem CID 54545945) has the molecular formula C17H15ClFN3O and a molecular weight of 331.78 g/mol. Its IUPAC name is (3S)-7-amino-6-chloro-5-(2-fluorophenyl)-1,3-dimethyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-7-amino-6-chloro-5-(2-fluorophenyl)-1,3-dimethyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 54545945 |
| Molecular Formula | C17H15ClFN3O |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (3S)-7-amino-6-chloro-5-(2-fluorophenyl)-1,3-dimethyl-3H-1,4-benzodiazepin-2-one |
| SMILES | C[C@@H]1N=C(c2ccccc2F)c2c(ccc(N)c2Cl)N(C)C1=O |
| InChI | InChI=1S/C17H15ClFN3O/c1-9-17(23)22(2)13-8-7-12(20)15(18)14(13)16(21-9)10-5-3-4-6-11(10)19/h3-9H,20H2,1-2H3/t9-/m0/s1 |
| InChIKey | ZGNJPXQHSLCZMT-VIFPVBQESA-N |
| XLogP | 3.26 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|