C16H11F3N2O — CID 23332661
3,7-difluoro-5-(2-fluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (PubChem CID 23332661) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 3,7-difluoro-5-(2-fluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 3,7-difluoro-5-(2-fluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 23332661 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3,7-difluoro-5-(2-fluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)C(F)N=C(c2ccccc2F)c2cc(F)ccc21 |
| InChI | InChI=1S/C16H11F3N2O/c1-21-13-7-6-9(17)8-11(13)14(20-15(19)16(21)22)10-4-2-3-5-12(10)18/h2-8,15H,1H3 |
| InChIKey | OMZRXZJNFCNSOQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|