C17H12BrFN2O2 — CID 172771724
7-bromo-5-(2-fluorophenyl)-3-(hydroxymethylidene)-1-methyl-1,4-benzodiazepin-2-one (PubChem CID 172771724) has the molecular formula C17H12BrFN2O2 and a molecular weight of 375.20 g/mol. Its IUPAC name is 7-bromo-5-(2-fluorophenyl)-3-(hydroxymethylidene)-1-methyl-1,4-benzodiazepin-2-one.
| Compound Name | 7-bromo-5-(2-fluorophenyl)-3-(hydroxymethylidene)-1-methyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 172771724 |
| Molecular Formula | C17H12BrFN2O2 |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 7-bromo-5-(2-fluorophenyl)-3-(hydroxymethylidene)-1-methyl-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)C(=CO)N=C(c2ccccc2F)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H12BrFN2O2/c1-21-15-7-6-10(18)8-12(15)16(20-14(9-22)17(21)23)11-4-2-3-5-13(11)19/h2-9,22H,1H3 |
| InChIKey | NAURBPHYFKDTHX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|