C20H20FN3O2 — CID 86738350
5-(2-fluorophenyl)-7-(N-hydroxy-C-methylcarbonimidoyl)-1,3,3-trimethyl-1,4-benzodiazepin-2-one (PubChem CID 86738350) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-7-(N-hydroxy-C-methylcarbonimidoyl)-1,3,3-trimethyl-1,4-benzodiazepin-2-one.
| Compound Name | 5-(2-fluorophenyl)-7-(N-hydroxy-C-methylcarbonimidoyl)-1,3,3-trimethyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 86738350 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 5-(2-fluorophenyl)-7-(N-hydroxy-C-methylcarbonimidoyl)-1,3,3-trimethyl-1,4-benzodiazepin-2-one |
| SMILES | CC(=NO)c1ccc2c(c1)C(c1ccccc1F)=NC(C)(C)C(=O)N2C |
| InChI | InChI=1S/C20H20FN3O2/c1-12(23-26)13-9-10-17-15(11-13)18(14-7-5-6-8-16(14)21)22-20(2,3)19(25)24(17)4/h5-11,26H,1-4H3 |
| InChIKey | KBPXSMKZZUNVLD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|