C16H15ClF2N4O2S — CID 175859265
7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-4H-pyrimido[4,5-d]pyrimidine-2-thione (PubChem CID 175859265) has the molecular formula C16H15ClF2N4O2S and a molecular weight of 400.84 g/mol. Its IUPAC name is 7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-4H-pyrimido[4,5-d]pyrimidine-2-thione.
| Compound Name | 7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-4H-pyrimido[4,5-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 175859265 |
| Molecular Formula | C16H15ClF2N4O2S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 7-chloro-3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-4H-pyrimido[4,5-d]pyrimidine-2-thione |
| SMILES | CCN1C(=S)N(c2c(F)c(OC)cc(OC)c2F)Cc2cnc(Cl)nc21 |
| InChI | InChI=1S/C16H15ClF2N4O2S/c1-4-22-14-8(6-20-15(17)21-14)7-23(16(22)26)13-11(18)9(24-2)5-10(25-3)12(13)19/h5-6H,4,7H2,1-3H3 |
| InChIKey | CMYYMNXFYRVJSG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|