C24H28ClN3O5 — CID 175861138
tert-butyl (4aS,7aR)-1-[(2R)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyrazine-4-carboxylate (PubChem CID 175861138) has the molecular formula C24H28ClN3O5 and a molecular weight of 473.96 g/mol. Its IUPAC name is tert-butyl (4aS,7aR)-1-[(2R)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyrazine-4-carboxylate.
| Compound Name | tert-butyl (4aS,7aR)-1-[(2R)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 175861138 |
| Molecular Formula | C24H28ClN3O5 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | tert-butyl (4aS,7aR)-1-[(2R)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]-2,3,4a,5,7,7a-hexahydrofuro[3,4-b]pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc3c2O[C@](C)(c2ccc(Cl)cn2)O3)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C24H28ClN3O5/c1-23(2,3)33-22(29)28-11-10-27(17-13-30-14-18(17)28)16-6-5-7-19-21(16)32-24(4,31-19)20-9-8-15(25)12-26-20/h5-9,12,17-18H,10-11,13-14H2,1-4H3/t17-,18+,24+/m0/s1 |
| InChIKey | KJELUJOCNWBDTF-HOOSLVGPSA-N |
| XLogP | 4.20 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |