C20H18BrN5O4 — CID 175861351
N-[(2S)-3-(3-bromophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-(2-nitrophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 175861351) has the molecular formula C20H18BrN5O4 and a molecular weight of 472.30 g/mol. Its IUPAC name is N-[(2S)-3-(3-bromophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-(2-nitrophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2S)-3-(3-bromophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-(2-nitrophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175861351 |
| Molecular Formula | C20H18BrN5O4 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | N-[(2S)-3-(3-bromophenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-(2-nitrophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CNC(=O)[C@H](Cc1cccc(Br)c1)NC(=O)c1cc(-c2ccccc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C20H18BrN5O4/c1-22-19(27)16(10-12-5-4-6-13(21)9-12)23-20(28)17-11-15(24-25-17)14-7-2-3-8-18(14)26(29)30/h2-9,11,16H,10H2,1H3,(H,22,27)(H,23,28)(H,24,25)/t16-/m0/s1 |
| InChIKey | ZSJZAKHVTQVSKR-INIZCTEOSA-N |
| XLogP | 2.83 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|