C26H25N3O4 — CID 175862605
(2S)-2-amino-N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-3-phenylpropanamide (PubChem CID 175862605) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 175862605 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2S)-2-amino-N-[2-methoxy-5-[methyl-(2-oxochromen-3-yl)amino]phenyl]-3-phenylpropanamide |
| SMILES | COc1ccc(N(C)c2cc3ccccc3oc2=O)cc1NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C26H25N3O4/c1-29(22-15-18-10-6-7-11-23(18)33-26(22)31)19-12-13-24(32-2)21(16-19)28-25(30)20(27)14-17-8-4-3-5-9-17/h3-13,15-16,20H,14,27H2,1-2H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | OGJAPDLVCPYBIG-FQEVSTJZSA-N |
| XLogP | 4.08 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|